CAS 16018-83-0 appears in our catalog under these names: 1-(4-Fluorophenyl)biguanide hydrochloride, 95%, 1-(4-Fluorophenyl)biguanide hydrochloride 98%, 1-(4-Fluorophenyl)biguanide, HCl, 98%, 98%, 1-(4-Fluorophenyl)biguanide hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-(diaminomethylidene)-2-(4-fluorophenyl)guanidine;hydrochloride (CAS 16018-83-0) is a chemical compound with the molecular formula C8H11ClFN5 and a molecular weight of 231.66 g/mol. IUPAC name: 1-(diaminomethylidene)-2-(4-fluorophenyl)guanidine;hydrochloride. InChIKey: HBYJTLZNKNUTCP-UHFFFAOYSA-N.
| Molecular formula | C8H11ClFN5 |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 1-(diaminomethylidene)-2-(4-fluorophenyl)guanidine;hydrochloride |
| InChIKey | HBYJTLZNKNUTCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C(N)N=C(N)N)F.Cl |
Computed by PubChem (NCBI)