1-(4-Methoxybenzyl)-5,6,7,8-tetrahydroisoquinoline, 95%
cas: 23974-90-5 — see every product listed under this CAS number, including other names
1-(4-Methoxybenzyl)-5,6,7,8-tetrahydroisoquinoline, 95% (CAS 23974-90-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1496716-100mg |
| cas | 23974-90-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2795.62 Pln | |
| BLDpharm | 100mg | 225.50 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 758.65 Pln | |
| BLDpharm | 5g | 2830.14 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 938.00 Pln | |
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 1g | 1731.70 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydroisoquinoline (CAS 23974-90-5) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydroisoquinoline. InChIKey: GKJRESRKVANGPR-UHFFFAOYSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydroisoquinoline |
| InChIKey | GKJRESRKVANGPR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=NC=CC3=C2CCCC3 |
Computed by PubChem (NCBI)