cas: 96449-89-7 — see every product listed under this CAS number, including other names
1-(4-Methoxybenzyl)-5-oxopyrrolidine-3-carboxylic acid, 95%, 95% (CAS 96449-89-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJTA-250mg |
| cas | 96449-89-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1576.40 Pln | |
| Chemat | 100mg | 198.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 96449-89-7) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: GQWNIXGHJLCLCG-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | GQWNIXGHJLCLCG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2CC(CC2=O)C(=O)O |
Computed by PubChem (NCBI)