cas: 26170-93-4 — see every product listed under this CAS number, including other names
1-(4-Phenylthiophen-2-yl)ethan-1-one (CAS 26170-93-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633459-1G |
| cas | 26170-93-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1752.53 Pln | |
| Fluorochem | 5g | 5110.72 Pln |
| delivery time | 3-4 weeks |
|---|
1-(4-phenylthiophen-2-yl)ethanone (CAS 26170-93-4) is a chemical compound with the molecular formula C12H10OS and a molecular weight of 202.27 g/mol. IUPAC name: 1-(4-phenylthiophen-2-yl)ethanone. InChIKey: DGPMAEGGTASVJO-UHFFFAOYSA-N.
| Molecular formula | C12H10OS |
|---|---|
| Molecular weight | 202.27 g/mol |
| IUPAC name | 1-(4-phenylthiophen-2-yl)ethanone |
| InChIKey | DGPMAEGGTASVJO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CS1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)