cas: 1795395-12-8 — see every product listed under this CAS number, including other names
1-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine hydrochloride, 95% (CAS 1795395-12-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1112911-1g |
| cas | 1795395-12-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 5063.17 Pln | |
| AmBeed | 5g | 13018.39 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (CAS 1795395-12-8) is a chemical compound with the molecular formula C8H11ClF3N3O and a molecular weight of 257.64 g/mol. IUPAC name: 1-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride. InChIKey: DICYDLMCSMWHIE-UHFFFAOYSA-N.
| Molecular formula | C8H11ClF3N3O |
|---|---|
| Molecular weight | 257.64 g/mol |
| IUPAC name | 1-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| InChIKey | DICYDLMCSMWHIE-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=NOC(=N2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)