CAS 222159-87-7 appears in our catalog under these names: 1-(5-Aminopentyl)-1h-pyrrole-2,5-dione 2,2,2-trifluoroacetate, 95%, N-(5-Aminopentyl)maleimide Trifluoroacetic Acid Salt, 1–(5–Aminopentyl)–1H–pyrrole–2,5–dione 2,2,2–trifluoroacetate, 1-(5-Aminopentyl)-1H-Pyrrole-2,5-Dione 2,2,2-Trifluoroacetate, 95%+, 95%+, 1-(5-Aminopentyl)-1H-pyrrole-2,5-dione 2,2,2-trifluoroacetate, 98%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 25mg, 500mg, 10g.
1-(5-aminopentyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (CAS 222159-87-7) is a chemical compound with the molecular formula C11H15F3N2O4 and a molecular weight of 296.24 g/mol. IUPAC name: 1-(5-aminopentyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid. InChIKey: LJWKDXOJBJSKTA-UHFFFAOYSA-N.
| Molecular formula | C11H15F3N2O4 |
|---|---|
| Molecular weight | 296.24 g/mol |
| IUPAC name | 1-(5-aminopentyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| InChIKey | LJWKDXOJBJSKTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCCCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)