cas: 1423-63-8 — see every product listed under this CAS number, including other names
1-(5-Bromobenzo[b]thiophen-3-yl)ethanone 96% (CAS 1423-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A997387-1g |
| cas | 1423-63-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 559.50 Pln | |
| Ambeed | 5g | 1772.12 Pln | |
| Ambeed | 10g | 3023.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A997387 |
1-(5-bromo-1-benzothiophen-3-yl)ethanone (CAS 1423-63-8) is a chemical compound with the molecular formula C10H7BrOS and a molecular weight of 255.13 g/mol. IUPAC name: 1-(5-bromo-1-benzothiophen-3-yl)ethanone. InChIKey: IRGMTUHYELTYEG-UHFFFAOYSA-N.
| Molecular formula | C10H7BrOS |
|---|---|
| Molecular weight | 255.13 g/mol |
| IUPAC name | 1-(5-bromo-1-benzothiophen-3-yl)ethanone |
| InChIKey | IRGMTUHYELTYEG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CSC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)