CAS 1883347-28-1 appears in our catalog under these names: 1–(5–Bromopyridin–3–yl)–2,2,2–trifluoroethanone hydrochloride, 1-(5-Bromopyridin-3-yl)-2,2,2-trifluoroethanone hydrochloride, 95%, 95%, 1-(5-Bromopyridin-3-yl)-2,2,2-trifluoroethanone hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethanone;hydrochloride (CAS 1883347-28-1) is a chemical compound with the molecular formula C7H4BrClF3NO and a molecular weight of 290.46 g/mol. IUPAC name: 1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethanone;hydrochloride. InChIKey: RSBFCATUZMLWIQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3NO |
|---|---|
| Molecular weight | 290.46 g/mol |
| IUPAC name | 1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethanone;hydrochloride |
| InChIKey | RSBFCATUZMLWIQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)C(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)