cas: 51843-24-4 — see every product listed under this CAS number, including other names
1-(5-Chloro-1H-indol-3-yl)ethanone, 97% (CAS 51843-24-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093357-250MG |
| cas | 51843-24-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 820.56 Pln | |
| Fluorochem | 10g | 1580.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(5-chloro-1H-indol-3-yl)ethanone (CAS 51843-24-4) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 1-(5-chloro-1H-indol-3-yl)ethanone. InChIKey: LEUBXJIHEAWOHZ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 1-(5-chloro-1H-indol-3-yl)ethanone |
| InChIKey | LEUBXJIHEAWOHZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CNC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)