cas: 70978-37-9 — see every product listed under this CAS number, including other names
1-(Azidomethyl)-4-methoxybenzene, 97%, 97% (CAS 70978-37-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116F84-100mg |
| cas | 70978-37-9 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 458.00 Pln | |
| Chemat | 50g | 784.40 Pln | |
| Chemat | 100g | 1499.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(azidomethyl)-4-methoxybenzene (CAS 70978-37-9) is a chemical compound with the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. IUPAC name: 1-(azidomethyl)-4-methoxybenzene. InChIKey: IAKGGJYLHBHSQD-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O |
|---|---|
| Molecular weight | 163.18 g/mol |
| IUPAC name | 1-(azidomethyl)-4-methoxybenzene |
| InChIKey | IAKGGJYLHBHSQD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)