CAS 865760-13-0 appears in our catalog under these names: 1-(Benzofuran-6-yl)ethanone, 97%, 97%, 1-(BENZOFURAN-6-YL)ETHAN-1-ONE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(1-benzofuran-6-yl)ethanone (CAS 865760-13-0) is a chemical compound with the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. IUPAC name: 1-(1-benzofuran-6-yl)ethanone. InChIKey: OZSFNSCLJFRYPC-UHFFFAOYSA-N.
| Molecular formula | C10H8O2 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 1-(1-benzofuran-6-yl)ethanone |
| InChIKey | OZSFNSCLJFRYPC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=CO2 |
Computed by PubChem (NCBI)