cas: 151038-76-5 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-2-bromo-4-chlorobenzene (CAS 151038-76-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629253-1G |
| cas | 151038-76-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1325.59 Pln | |
| Fluorochem | 5g | 3840.33 Pln |
| delivery time | 3-4 weeks |
|---|
2-bromo-4-chloro-1-phenylmethoxybenzene (CAS 151038-76-5) is a chemical compound with the molecular formula C13H10BrClO and a molecular weight of 297.57 g/mol. IUPAC name: 2-bromo-4-chloro-1-phenylmethoxybenzene. InChIKey: MUPMHWOWVDUINO-UHFFFAOYSA-N.
| Molecular formula | C13H10BrClO |
|---|---|
| Molecular weight | 297.57 g/mol |
| IUPAC name | 2-bromo-4-chloro-1-phenylmethoxybenzene |
| InChIKey | MUPMHWOWVDUINO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Cl)Br |
Computed by PubChem (NCBI)