cas: 2830-53-7 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-2-bromo-4-methylbenzene, 98% (CAS 2830-53-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218688-1G |
| cas | 2830-53-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 456.11 Pln | |
| Fluorochem | 25g | 690.40 Pln | |
| Fluorochem | 100g | 2580.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-4-methyl-1-phenylmethoxybenzene (CAS 2830-53-7) is a chemical compound with the molecular formula C14H13BrO and a molecular weight of 277.16 g/mol. IUPAC name: 2-bromo-4-methyl-1-phenylmethoxybenzene. InChIKey: VKHZSLPJRBZFCI-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO |
|---|---|
| Molecular weight | 277.16 g/mol |
| IUPAC name | 2-bromo-4-methyl-1-phenylmethoxybenzene |
| InChIKey | VKHZSLPJRBZFCI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)