cas: 5544-60-5 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-4-(bromomethyl)benzene, 98% (CAS 5544-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446461-100MG |
| cas | 5544-60-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 612.30 Pln | |
| Fluorochem | 1g | 1237.08 Pln | |
| Fluorochem | 5g | 3684.14 Pln | |
| Fluorochem | 10g | 7313.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(bromomethyl)-4-phenylmethoxybenzene (CAS 5544-60-5) is a chemical compound with the molecular formula C14H13BrO and a molecular weight of 277.16 g/mol. IUPAC name: 1-(bromomethyl)-4-phenylmethoxybenzene. InChIKey: KHZAFUOYPXXJKO-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO |
|---|---|
| Molecular weight | 277.16 g/mol |
| IUPAC name | 1-(bromomethyl)-4-phenylmethoxybenzene |
| InChIKey | KHZAFUOYPXXJKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)