cas: 17281-59-3 — see every product listed under this CAS number, including other names
1-(Cyanomethyl)pyridinium Chloride, >95.0%(HPLC)(T) (CAS 17281-59-3) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C0848-5G |
| cas | 17281-59-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 237.85 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC)(T) |
2-pyridin-1-ium-1-ylacetonitrile chloride (CAS 17281-59-3) is a chemical compound with the molecular formula C7H7ClN2 and a molecular weight of 154.60 g/mol. IUPAC name: 2-pyridin-1-ium-1-ylacetonitrile chloride. InChIKey: HEJOROWXIWLCMS-UHFFFAOYSA-M.
| Molecular formula | C7H7ClN2 |
|---|---|
| Molecular weight | 154.60 g/mol |
| IUPAC name | 2-pyridin-1-ium-1-ylacetonitrile chloride |
| InChIKey | HEJOROWXIWLCMS-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C=C1)CC#N.[Cl-] |
Computed by PubChem (NCBI)