cas: 40675-81-8 — see every product listed under this CAS number, including other names
1-(Naphthalen-1-ylmethyl)piperazine 98% (CAS 40675-81-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A336396-250mg |
| cas | 40675-81-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 592.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A336396 |
1-(naphthalen-1-ylmethyl)piperazine (CAS 40675-81-8) is a chemical compound with the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. IUPAC name: 1-(naphthalen-1-ylmethyl)piperazine. InChIKey: HGYDREHWXXUUIS-UHFFFAOYSA-N.
| Molecular formula | C15H18N2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | 1-(naphthalen-1-ylmethyl)piperazine |
| InChIKey | HGYDREHWXXUUIS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)