cas: 1190430-21-7 — see every product listed under this CAS number, including other names
1-(Perfluorobut-1-yl)pentane, 95%, 95% (CAS 1190430-21-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119XP0-250mg |
| cas | 1190430-21-7 |
| size | 250mg |
| availability | 90.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1336.40 Pln | |
| Chemat | 25g | 2474.00 Pln | |
| Chemat | 50g | 4542.80 Pln | |
| Chemat | 100mg | 107.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,1,1,2,2,3,3,4,4-nonafluorononane (CAS 1190430-21-7) is a chemical compound with the molecular formula C9H11F9 and a molecular weight of 290.17 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4-nonafluorononane. InChIKey: GYDMBTYTWYNRGO-UHFFFAOYSA-N.
| Molecular formula | C9H11F9 |
|---|---|
| Molecular weight | 290.17 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4-nonafluorononane |
| InChIKey | GYDMBTYTWYNRGO-UHFFFAOYSA-N |
| SMILES | CCCCCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)