CAS 306935-37-5 is the registry number for 1-(Piperidin-4-yl)-5-(trifluoromethyl)-1H-benzo[d][1,2,3]triazole hydrochloride, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrochloride (CAS 306935-37-5) is a chemical compound with the molecular formula C12H14ClF3N4 and a molecular weight of 306.71 g/mol. IUPAC name: 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrochloride. InChIKey: OBGFRHXXUYUYOS-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF3N4 |
|---|---|
| Molecular weight | 306.71 g/mol |
| IUPAC name | 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrochloride |
| InChIKey | OBGFRHXXUYUYOS-UHFFFAOYSA-N |
| SMILES | C1CNCCC1N2C3=C(C=C(C=C3)C(F)(F)F)N=N2.Cl |
Computed by PubChem (NCBI)