cas: 916766-91-1 — see every product listed under this CAS number, including other names
1-(Thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carbaldehyde, 97%, 97% (CAS 916766-91-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GVOA-250mg |
| cas | 916766-91-1 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 1744.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carbaldehyde (CAS 916766-91-1) is a chemical compound with the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. IUPAC name: 1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carbaldehyde. InChIKey: YGMBYHWGCCTCNN-UHFFFAOYSA-N.
| Molecular formula | C12H13N3OS |
|---|---|
| Molecular weight | 247.32 g/mol |
| IUPAC name | 1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carbaldehyde |
| InChIKey | YGMBYHWGCCTCNN-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C=O)C2=NC=NC3=C2SC=C3 |
Computed by PubChem (NCBI)