cas: 202737-33-5 — see every product listed under this CAS number, including other names
1-(Thiophen-2-yl)cyclobutanecarboxylic acid, 97% (CAS 202737-33-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F763865-500MG |
| cas | 202737-33-5 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1471.37 Pln | |
| Fluorochem | 1g | 2278.38 Pln | |
| Fluorochem | 5g | 6683.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-thiophen-2-ylcyclobutane-1-carboxylic acid (CAS 202737-33-5) is a chemical compound with the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. IUPAC name: 1-thiophen-2-ylcyclobutane-1-carboxylic acid. InChIKey: ZSEXSJBRGWJIBW-UHFFFAOYSA-N.
| Molecular formula | C9H10O2S |
|---|---|
| Molecular weight | 182.24 g/mol |
| IUPAC name | 1-thiophen-2-ylcyclobutane-1-carboxylic acid |
| InChIKey | ZSEXSJBRGWJIBW-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)