cas: 29540-81-6 — see every product listed under this CAS number, including other names
1-(Trifluoromethanesulfonyl)imidazole, 97% (CAS 29540-81-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007528-25G |
| cas | 29540-81-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 1950.37 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 534.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(trifluoromethylsulfonyl)imidazole (CAS 29540-81-6) is a chemical compound with the molecular formula C4H3F3N2O2S and a molecular weight of 200.14 g/mol. IUPAC name: 1-(trifluoromethylsulfonyl)imidazole. InChIKey: YGABUCCNCBMODG-UHFFFAOYSA-N.
| Molecular formula | C4H3F3N2O2S |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | 1-(trifluoromethylsulfonyl)imidazole |
| InChIKey | YGABUCCNCBMODG-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)