cas: 1255666-29-5 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-2-(methoxycarbonyl)piperidine-4-carboxylic acid, 97% (CAS 1255666-29-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A715791-1g |
| cas | 1255666-29-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4262.44 Pln | |
| AmBeed | 10g | 19176.85 Pln | |
| AmBeed | 5g | 11429.95 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1255666-29-5) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: 2-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: VPZOZPSOJLQFGC-UHFFFAOYSA-N.
| Molecular formula | C13H21NO6 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 2-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | VPZOZPSOJLQFGC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)