cas: 1303972-81-7 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-3,3-difluoropiperidine-4-carboxylic acid, 97.0% (CAS 1303972-81-7) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 500 mg, 250 mg, 100 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W001386-5 g |
| cas | 1303972-81-7 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 4281.02 Pln | |
| MedChemExpress | 500 mg | 649.42 Pln | |
| MedChemExpress | 250 mg | 445.08 Pln | |
| MedChemExpress | 100 mg | 273.25 Pln | |
| MedChemExpress | 1 g | 1058.09 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1303972-81-7) is a chemical compound with the molecular formula C11H17F2NO4 and a molecular weight of 265.25 g/mol. IUPAC name: 3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: HZMYOCGJMSBEDV-UHFFFAOYSA-N.
| Molecular formula | C11H17F2NO4 |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | 3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | HZMYOCGJMSBEDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)(F)F)C(=O)O |
Computed by PubChem (NCBI)