cas: 1260649-60-2 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-3-(trifluoromethyl)piperidine-4-carboxylic acid 95% (CAS 1260649-60-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A979058-250mg |
| cas | 1260649-60-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1388.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A979058 |
1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)piperidine-4-carboxylic acid (CAS 1260649-60-2) is a chemical compound with the molecular formula C12H18F3NO4 and a molecular weight of 297.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)piperidine-4-carboxylic acid. InChIKey: FZQHRSMRHOQSOY-UHFFFAOYSA-N.
| Molecular formula | C12H18F3NO4 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)piperidine-4-carboxylic acid |
| InChIKey | FZQHRSMRHOQSOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)