cas: 1158750-72-1 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-4-(4-methoxyphenyl)piperidine-4-carboxylic acid, 97% (CAS 1158750-72-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F096348-250MG |
| cas | 1158750-72-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 500mg | 1726.49 Pln | |
| Fluorochem | 1g | 2720.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-methoxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1158750-72-1) is a chemical compound with the molecular formula C18H25NO5 and a molecular weight of 335.4 g/mol. IUPAC name: 4-(4-methoxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: ZZTINMROZIPULP-UHFFFAOYSA-N.
| Molecular formula | C18H25NO5 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | ZZTINMROZIPULP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=CC=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)