cas: 335649-61-1 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-5-(tert-butyldimethylsilyloxy)-1H-indol-2-ylboronic acid 98% (CAS 335649-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A636833-100mg |
| cas | 335649-61-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 715.25 Pln | |
| Ambeed | 1g | 1583.00 Pln | |
| Ambeed | 5g | 5371.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A636833 |
[5-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 335649-61-1) is a chemical compound with the molecular formula C19H30BNO5Si and a molecular weight of 391.3 g/mol. IUPAC name: [5-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: NXKIUYOUKLIWLP-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO5Si |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | [5-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | NXKIUYOUKLIWLP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)