cas: 885274-99-7 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-5-phenylpiperidine-3-carboxylic acid, 97% (CAS 885274-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329448-100MG |
| cas | 885274-99-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1403.69 Pln | |
| Fluorochem | 250mg | 1846.24 Pln | |
| Fluorochem | 500mg | 3512.32 Pln | |
| Fluorochem | 1g | 5001.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpiperidine-3-carboxylic acid (CAS 885274-99-7) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpiperidine-3-carboxylic acid. InChIKey: BNUHNLZVJMQDJJ-UHFFFAOYSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpiperidine-3-carboxylic acid |
| InChIKey | BNUHNLZVJMQDJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(C1)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)