cas: 187795-43-3 — see every product listed under this CAS number, including other names
1-(tert-Butyl)-3-cyclopropyl-1H-pyrazol-5-amine, 95%,RG, 95%,RG (CAS 187795-43-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GHN-100mg |
| cas | 187795-43-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 467.60 Pln |
| purity | 95%,RG |
|---|---|
| delivery time | 3 weeks |
1-tert-butyl-3-cyclopropylpyrazol-5-amine (CAS 187795-43-3) is a chemical compound with the molecular formula C10H17N3 and a molecular weight of 179.26 g/mol. IUPAC name: 1-tert-butyl-3-cyclopropylpyrazol-5-amine. InChIKey: OTJPHLDPFRTLNZ-UHFFFAOYSA-N.
| Molecular formula | C10H17N3 |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | 1-tert-butyl-3-cyclopropylpyrazol-5-amine |
| InChIKey | OTJPHLDPFRTLNZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=CC(=N1)C2CC2)N |
Computed by PubChem (NCBI)