cas: 6435-78-5 — see every product listed under this CAS number, including other names
1-[(4-methylphenyl)sulfonyl]pyrrolidine, 97%, 97% (CAS 6435-78-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EIYV-100mg |
| cas | 6435-78-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 10g | 986.00 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 582.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-methylphenyl)sulfonylpyrrolidine (CAS 6435-78-5) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpyrrolidine. InChIKey: KDWPQSBXEHQMSD-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpyrrolidine |
| InChIKey | KDWPQSBXEHQMSD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCCC2 |
Computed by PubChem (NCBI)