cas: 864754-16-5 — see every product listed under this CAS number, including other names
1-[(Ethoxycarbonyl)methyl]-1H-pyrazole-4-boronic acid pinacol ester, 97% (CAS 864754-16-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 445010010 |
| cas | 864754-16-5 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 489.99 Pln | |
| Thermo Scientific (Acros) | 5g | 1688.24 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate (CAS 864754-16-5) is a chemical compound with the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate. InChIKey: YUEZJHOSHBTWPV-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O4 |
|---|---|
| Molecular weight | 280.13 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate |
| InChIKey | YUEZJHOSHBTWPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(=O)OCC |
Computed by PubChem (NCBI)