cas: 1822567-84-9 — see every product listed under this CAS number, including other names
1-[(tert-butoxy)carbonyl]-3,3-difluoropyrrolidine-2-carboxylic acid, 97%, 97% (CAS 1822567-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K0IM-100mg |
| cas | 1822567-84-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 990.80 Pln | |
| Chemat | 250mg | 1960.40 Pln | |
| Chemat | 500mg | 3237.20 Pln | |
| Chemat | 1g | 4240.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1822567-84-9) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: 3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: KYKGTPMAQQHAOU-UHFFFAOYSA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | KYKGTPMAQQHAOU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1C(=O)O)(F)F |
Computed by PubChem (NCBI)