cas: 368866-21-1 — see every product listed under this CAS number, including other names
1-[(tert-butoxy)carbonyl]-3-{[(9h-fluoren-9-ylmethoxy)carbonyl]amino}piperidine-3-carboxylic acid, 97% (CAS 368866-21-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F639523-250MG |
| cas | 368866-21-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1403.69 Pln | |
| Fluorochem | 500mg | 2132.60 Pln | |
| Fluorochem | 1g | 3309.27 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 368866-21-1) is a chemical compound with the molecular formula C26H30N2O6 and a molecular weight of 466.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: VXJHDZRKJBBFKW-UHFFFAOYSA-N.
| Molecular formula | C26H30N2O6 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | VXJHDZRKJBBFKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)