1-[2,2-Bis(4-methylphenyl)ethenyl]-4-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]benzene, 99% (CAS 135804-06-7) manufactured by Lumtec in a 1g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-E406-1g |
| cas | 135804-06-7 |
| size | 1g |
| availability | 12.11.2021: In Stock |
| purity | 99% |
|---|
1-[2,2-bis(4-methylphenyl)ethenyl]-4-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]benzene (CAS 135804-06-7) is a chemical compound with the molecular formula C44H38 and a molecular weight of 566.8 g/mol. IUPAC name: 1-[2,2-bis(4-methylphenyl)ethenyl]-4-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]benzene. InChIKey: PNJTZJDRBBJYKP-UHFFFAOYSA-N.
| Molecular formula | C44H38 |
|---|---|
| Molecular weight | 566.8 g/mol |
| IUPAC name | 1-[2,2-bis(4-methylphenyl)ethenyl]-4-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]benzene |
| InChIKey | PNJTZJDRBBJYKP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=CC2=CC=C(C=C2)C3=CC=C(C=C3)C=C(C4=CC=C(C=C4)C)C5=CC=C(C=C5)C)C6=CC=C(C=C6)C |
Computed by PubChem (NCBI)