cas: 2158527-43-4 — see every product listed under this CAS number, including other names
1-[2-(4-iodopyrazol-1-yl)ethyl]pyrrolidin-2-one, 97% (CAS 2158527-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch135TKD-100mg |
| cas | 2158527-43-4 |
| size | 100mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1163.60 Pln | |
| Chemat | 250mg | 1902.80 Pln | |
| Chemat | 500mg | 2637.20 Pln | |
| Chemat | 1g | 3741.20 Pln | |
| Fluorochem | 100mg | 2153.43 Pln | |
| Fluorochem | 250mg | 3512.32 Pln | |
| Fluorochem | 500mg | 4886.84 Pln | |
| Fluorochem | 1g | 6808.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[2-(4-iodopyrazol-1-yl)ethyl]pyrrolidin-2-one (CAS 2158527-43-4) is a chemical compound with the molecular formula C9H12IN3O and a molecular weight of 305.12 g/mol. IUPAC name: 1-[2-(4-iodopyrazol-1-yl)ethyl]pyrrolidin-2-one. InChIKey: CTKGFAPWBOOAHM-UHFFFAOYSA-N.
| Molecular formula | C9H12IN3O |
|---|---|
| Molecular weight | 305.12 g/mol |
| IUPAC name | 1-[2-(4-iodopyrazol-1-yl)ethyl]pyrrolidin-2-one |
| InChIKey | CTKGFAPWBOOAHM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)CCN2C=C(C=N2)I |
Computed by PubChem (NCBI)