cas: 864750-70-9 — see every product listed under this CAS number, including other names
1-[2-[[4-[[4-(Aminocarbonyl)-1-piperidinyl]methyl]benzoyl]methylamino]ethyl]-4-piperidinyl N-[1,1′-biphenyl]-2-ylcarbamate, 98+%, 98+% (CAS 864750-70-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H2KA-1mg |
| cas | 864750-70-9 |
| size | 1mg |
| availability | 15g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 102.80 Pln | |
| Chemat | 5mg | 165.20 Pln | |
| Chemat | 10mg | 218.00 Pln | |
| Chemat | 25mg | 323.60 Pln | |
| Chemat | 50mg | 510.80 Pln | |
| Chemat | 100mg | 822.80 Pln | |
| Chemat | 250mg | 1350.80 Pln | |
| Chemat | 1g | 4706.00 Pln | |
| Chemat | 5g | 18630.80 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
[1-[2-[[4-[(4-carbamoylpiperidin-1-yl)methyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (CAS 864750-70-9) is a chemical compound with the molecular formula C35H43N5O4 and a molecular weight of 597.7 g/mol. IUPAC name: [1-[2-[[4-[(4-carbamoylpiperidin-1-yl)methyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate. InChIKey: FYDWDCIFZSGNBU-UHFFFAOYSA-N.
| Molecular formula | C35H43N5O4 |
|---|---|
| Molecular weight | 597.7 g/mol |
| IUPAC name | [1-[2-[[4-[(4-carbamoylpiperidin-1-yl)methyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| InChIKey | FYDWDCIFZSGNBU-UHFFFAOYSA-N |
| SMILES | CN(CCN1CCC(CC1)OC(=O)NC2=CC=CC=C2C3=CC=CC=C3)C(=O)C4=CC=C(C=C4)CN5CCC(CC5)C(=O)N |
Computed by PubChem (NCBI)