cas: 243666-15-1 — see every product listed under this CAS number, including other names
1-[3-(Trifluoromethyl)pyrid-2-yl]-1,4-diazepane (CAS 243666-15-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017271-1G |
| cas | 243666-15-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1299.56 Pln |
| delivery time | 2-3 weeks |
|---|
1-[3-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane (CAS 243666-15-1) is a chemical compound with the molecular formula C11H14F3N3 and a molecular weight of 245.24 g/mol. IUPAC name: 1-[3-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane. InChIKey: BMKFDQXBPCCAFY-UHFFFAOYSA-N.
| Molecular formula | C11H14F3N3 |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
| InChIKey | BMKFDQXBPCCAFY-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C=CC=N2)C(F)(F)F |
Computed by PubChem (NCBI)