cas: 337919-65-0 — see every product listed under this CAS number, including other names
1-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]--4-piperidinecarboxylic acid (CAS 337919-65-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010064-100MG |
| cas | 337919-65-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 500mg | 768.50 Pln | |
| Fluorochem | 1g | 1476.58 Pln | |
| Fluorochem | 2g | 1674.43 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylic acid (CAS 337919-65-0) is a chemical compound with the molecular formula C12H12ClF3N2O2 and a molecular weight of 308.68 g/mol. IUPAC name: 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylic acid. InChIKey: GBLCZMUANRHJIZ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClF3N2O2 |
|---|---|
| Molecular weight | 308.68 g/mol |
| IUPAC name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylic acid |
| InChIKey | GBLCZMUANRHJIZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)