cas: 1268520-12-2 — see every product listed under this CAS number, including other names
1-Acetyl-2-methyl-D-proline, 97% (CAS 1268520-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1152622-1g |
| cas | 1268520-12-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3539.83 Pln | |
| AmBeed | 25g | 25289.74 Pln | |
| AmBeed | 5g | 8702.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-1-acetyl-2-methylpyrrolidine-2-carboxylic acid (CAS 1268520-12-2) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: (2R)-1-acetyl-2-methylpyrrolidine-2-carboxylic acid. InChIKey: VOSYPKQVDFIHEJ-MRVPVSSYSA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | (2R)-1-acetyl-2-methylpyrrolidine-2-carboxylic acid |
| InChIKey | VOSYPKQVDFIHEJ-MRVPVSSYSA-N |
| SMILES | CC(=O)N1CCC[C@]1(C)C(=O)O |
Computed by PubChem (NCBI)