CAS 61995-52-6 appears in our catalog under these names: 1–Acetyl–5–bromoindole, 1-Acetyl-5-bromoindole, 97% , 1-Acetyl-5-bromoindole, 1-Acetyl-5-bromoindole 97%, 1-Acetyl-5-bromoindole, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 1000mg, 2000mg, 5000mg, 100mg, 5g.
1-(5-bromoindol-1-yl)ethanone (CAS 61995-52-6) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 1-(5-bromoindol-1-yl)ethanone. InChIKey: BOMKWHSZGCMFEG-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 1-(5-bromoindol-1-yl)ethanone |
| InChIKey | BOMKWHSZGCMFEG-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=CC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)