cas: 134179-38-7 — see every product listed under this CAS number, including other names
1-Amino-11-azido-3,6,9-trioxaundecane, 98%, 98% (CAS 134179-38-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DUR-10g |
| cas | 134179-38-7 |
| size | 10g |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 100g | 4955.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 338.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanamine (CAS 134179-38-7) is a chemical compound with the molecular formula C8H18N4O3 and a molecular weight of 218.25 g/mol. IUPAC name: 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanamine. InChIKey: FPVCVHVTMPCZTH-UHFFFAOYSA-N.
| Molecular formula | C8H18N4O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanamine |
| InChIKey | FPVCVHVTMPCZTH-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCN=[N+]=[N-])N |
Computed by PubChem (NCBI)