cas: 614731-09-8 — see every product listed under this CAS number, including other names
1-BOC-4-FLUORO-4-FORMYL-PIPERIDINE, 95%, 95% (CAS 614731-09-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140CZ-50mg |
| cas | 614731-09-8 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 477.20 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 6266.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS 614731-09-8) is a chemical compound with the molecular formula C11H18FNO3 and a molecular weight of 231.26 g/mol. IUPAC name: tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate. InChIKey: GRSPYCFNEDACGF-UHFFFAOYSA-N.
| Molecular formula | C11H18FNO3 |
|---|---|
| Molecular weight | 231.26 g/mol |
| IUPAC name | tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate |
| InChIKey | GRSPYCFNEDACGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C=O)F |
Computed by PubChem (NCBI)