1-BOC-7-Methoxyindole-3-boronic acid, pinacol ester, 95%, 95%
cas: 1218790-26-1 — see every product listed under this CAS number, including other names
1-BOC-7-Methoxyindole-3-boronic acid, pinacol ester, 95%, 95% (CAS 1218790-26-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112702-100mg |
| cas | 1218790-26-1 |
| size | 100mg |
| availability | 6g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 645.20 Pln | |
| Chemat | 250mg | 1053.20 Pln | |
| Chemat | 1g | 2733.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 7-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 1218790-26-1) is a chemical compound with the molecular formula C20H28BNO5 and a molecular weight of 373.3 g/mol. IUPAC name: tert-butyl 7-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: GXVNJKPEAWTIRL-UHFFFAOYSA-N.
| Molecular formula | C20H28BNO5 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | tert-butyl 7-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | GXVNJKPEAWTIRL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=CC=C3OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)