cas: 53220-82-9 — see every product listed under this CAS number, including other names
1-BROMO-4-CHLORO-NAPHTHALENE, 98%, 98% (CAS 53220-82-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148Q3-250mg |
| cas | 53220-82-9 |
| size | 250mg |
| availability | 380.34g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 328.40 Pln | |
| Chemat | 50g | 587.60 Pln | |
| Chemat | 100g | 1096.40 Pln | |
| Chemat | 250g | 2267.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-chloronaphthalene (CAS 53220-82-9) is a chemical compound with the molecular formula C10H6BrCl and a molecular weight of 241.51 g/mol. IUPAC name: 1-bromo-4-chloronaphthalene. InChIKey: WUGJECZACFHDFE-UHFFFAOYSA-N.
| Molecular formula | C10H6BrCl |
|---|---|
| Molecular weight | 241.51 g/mol |
| IUPAC name | 1-bromo-4-chloronaphthalene |
| InChIKey | WUGJECZACFHDFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)Cl |
Computed by PubChem (NCBI)