cas: 40320-63-6 — see every product listed under this CAS number, including other names
1-Benzhydryl-3-methylazetidin-3-ol 95% (CAS 40320-63-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A309299-25g |
| cas | 40320-63-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 765.31 Pln | |
| Ambeed | 100g | 1850.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A309299 |
1-benzhydryl-3-methylazetidin-3-ol (CAS 40320-63-6) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: 1-benzhydryl-3-methylazetidin-3-ol. InChIKey: BCVZHHLJPZIBCC-UHFFFAOYSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | 1-benzhydryl-3-methylazetidin-3-ol |
| InChIKey | BCVZHHLJPZIBCC-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)