cas: 203661-73-8 — see every product listed under this CAS number, including other names
1-Benzyl-2-methylpiperidin-4-one (CAS 203661-73-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238672-250MG |
| cas | 203661-73-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1294.35 Pln | |
| Fluorochem | 1g | 4381.81 Pln |
| delivery time | 3-4 weeks |
|---|
1-benzyl-2-methylpiperidin-4-one (CAS 203661-73-8) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 1-benzyl-2-methylpiperidin-4-one. InChIKey: PBIZOPYFPXOGAW-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 1-benzyl-2-methylpiperidin-4-one |
| InChIKey | PBIZOPYFPXOGAW-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)CCN1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)