cas: 34737-89-8 — see every product listed under this CAS number, including other names
1-Benzyl-3-methylpiperidin-4-one (CAS 34737-89-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091511-1G |
| cas | 34737-89-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 591.48 Pln |
| delivery time | 2-3 weeks |
|---|
1-benzyl-3-methylpiperidin-4-one (CAS 34737-89-8) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 1-benzyl-3-methylpiperidin-4-one. InChIKey: OVQAJYCAXPHYNV-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 1-benzyl-3-methylpiperidin-4-one |
| InChIKey | OVQAJYCAXPHYNV-UHFFFAOYSA-N |
| SMILES | CC1CN(CCC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)