cas: 1015242-03-1 — see every product listed under this CAS number, including other names
1-Benzyl-4-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)piperazine, 98% (CAS 1015242-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696249-100MG |
| cas | 1015242-03-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 534.20 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 1g | 1466.17 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-benzyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine (CAS 1015242-03-1) is a chemical compound with the molecular formula C22H30BN3O2 and a molecular weight of 379.3 g/mol. IUPAC name: 1-benzyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine. InChIKey: AFNSMUFYAVDYMJ-UHFFFAOYSA-N.
| Molecular formula | C22H30BN3O2 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 1-benzyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
| InChIKey | AFNSMUFYAVDYMJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N3CCN(CC3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)