cas: 22065-85-6 — see every product listed under this CAS number, including other names
1-Benzyl-4-formylpiperidine, 95% (CAS 22065-85-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036505-1G |
| cas | 22065-85-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 100g | 726.85 Pln | |
| Fluorochem | 250g | 1544.27 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-benzylpiperidine-4-carbaldehyde (CAS 22065-85-6) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 1-benzylpiperidine-4-carbaldehyde. InChIKey: SGIBOXBBPQRZDM-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 1-benzylpiperidine-4-carbaldehyde |
| InChIKey | SGIBOXBBPQRZDM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)