cas: 1272756-11-2 — see every product listed under this CAS number, including other names
1-Benzyl-5-(aminomethyl)piperidin-2-one, >95%, >95% (CAS 1272756-11-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WV5-100mg |
| cas | 1272756-11-2 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 914.00 Pln | |
| Chemat | 250mg | 1062.80 Pln | |
| Chemat | 1g | 1394.00 Pln | |
| Chemat | 5g | 4595.60 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
5-(aminomethyl)-1-benzylpiperidin-2-one (CAS 1272756-11-2) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: 5-(aminomethyl)-1-benzylpiperidin-2-one. InChIKey: FEFJBHGNEBOGRH-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 5-(aminomethyl)-1-benzylpiperidin-2-one |
| InChIKey | FEFJBHGNEBOGRH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(CC1CN)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)