cas: 59702-21-5 — see every product listed under this CAS number, including other names
1-Benzylpiperazin-2-one, >97%, >97% (CAS 59702-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DZG-250mg |
| cas | 59702-21-5 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 904.40 Pln | |
| Chemat | 5g | 2598.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
1-benzylpiperazin-2-one (CAS 59702-21-5) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 1-benzylpiperazin-2-one. InChIKey: BNPCRHWMJSUKDM-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 1-benzylpiperazin-2-one |
| InChIKey | BNPCRHWMJSUKDM-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)